(2-Chloro-5-ethoxyphenyl)boronic acid, 98%
cas: 913835-30-0 — see every product listed under this CAS number, including other names
(2-Chloro-5-ethoxyphenyl)boronic acid, 98% (CAS 913835-30-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 50g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A284978-1g |
| cas | 913835-30-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1922.00 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 636.47 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2-chloro-5-ethoxyphenyl)boronic acid (CAS 913835-30-0) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (2-chloro-5-ethoxyphenyl)boronic acid. InChIKey: LIFPTULDIUUUBK-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (2-chloro-5-ethoxyphenyl)boronic acid |
| InChIKey | LIFPTULDIUUUBK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC)Cl)(O)O |
Computed by PubChem (NCBI)