cas: 152149-00-3 — see every product listed under this CAS number, including other names
(2-Chloro-benzothiazol-6-yl)-acetic acid, 96%, 96% (CAS 152149-00-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANYH-250mg |
| cas | 152149-00-3 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1686.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloro-1,3-benzothiazol-6-yl)acetic acid (CAS 152149-00-3) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: 2-(2-chloro-1,3-benzothiazol-6-yl)acetic acid. InChIKey: HBDVBZKFZBCJEW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | 2-(2-chloro-1,3-benzothiazol-6-yl)acetic acid |
| InChIKey | HBDVBZKFZBCJEW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC(=O)O)SC(=N2)Cl |
Computed by PubChem (NCBI)