CAS 1188165-88-9 is the registry number for 2-(4-Chloro-1,3-benzothiazol-2-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid (CAS 1188165-88-9) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: 2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid. InChIKey: CTTBVJTVGYNSIB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | 2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid |
| InChIKey | CTTBVJTVGYNSIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(S2)CC(=O)O |
Computed by PubChem (NCBI)