Products 1188165-88-9

CAS 1188165-88-9 is the registry number for 2-(4-Chloro-1,3-benzothiazol-2-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid (CAS 1188165-88-9) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: 2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid. InChIKey: CTTBVJTVGYNSIB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClNO2S
Molecular weight227.67 g/mol
IUPAC name2-(4-chloro-1,3-benzothiazol-2-yl)acetic acid
InChIKeyCTTBVJTVGYNSIB-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Cl)N=C(S2)CC(=O)O

Computed by PubChem (NCBI)