cas: 1072951-97-3 — see every product listed under this CAS number, including other names
(2-Isobutoxy-6-methoxyphenyl)boronic acid, 97% (CAS 1072951-97-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A737193-25g |
| cas | 1072951-97-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 10225.60 Pln | |
| AmBeed | 10g | 5147.80 Pln | |
| AmBeed | 5g | 3116.68 Pln | |
| AmBeed | 250mg | 493.15 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-methoxy-6-(2-methylpropoxy)phenyl]boronic acid (CAS 1072951-97-3) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: [2-methoxy-6-(2-methylpropoxy)phenyl]boronic acid. InChIKey: RROWNDUHJNWYQP-UHFFFAOYSA-N.
| Molecular formula | C11H17BO4 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | [2-methoxy-6-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | RROWNDUHJNWYQP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OCC(C)C)OC)(O)O |
Computed by PubChem (NCBI)