cas: 1072951-97-3 — see every product listed under this CAS number, including other names
2-Isobutoxy-6-methoxyphenylboronic acid, 98%, 98% (CAS 1072951-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BNK-100mg |
| cas | 1072951-97-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-methoxy-6-(2-methylpropoxy)phenyl]boronic acid (CAS 1072951-97-3) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: [2-methoxy-6-(2-methylpropoxy)phenyl]boronic acid. InChIKey: RROWNDUHJNWYQP-UHFFFAOYSA-N.
| Molecular formula | C11H17BO4 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | [2-methoxy-6-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | RROWNDUHJNWYQP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OCC(C)C)OC)(O)O |
Computed by PubChem (NCBI)