cas: 2121511-97-3 — see every product listed under this CAS number, including other names
(2-Methoxy-[1,1'-biphenyl]-4-yl)boronic acid, ≥95%, ≥95% (CAS 2121511-97-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12Q4OC-1g |
| cas | 2121511-97-3 |
| size | 1g |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2973.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3-methoxy-4-phenylphenyl)boronic acid (CAS 2121511-97-3) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: (3-methoxy-4-phenylphenyl)boronic acid. InChIKey: QPEBGCLQPCQHHI-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | (3-methoxy-4-phenylphenyl)boronic acid |
| InChIKey | QPEBGCLQPCQHHI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)