Products 2377611-29-3

CAS 2377611-29-3 is the registry number for 2-(3-Methylphenoxy)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[2-(3-methylphenoxy)phenyl]boronic acid (CAS 2377611-29-3) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: [2-(3-methylphenoxy)phenyl]boronic acid. InChIKey: CJWASTIUXJQLGA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13BO3
Molecular weight228.05 g/mol
IUPAC name[2-(3-methylphenoxy)phenyl]boronic acid
InChIKeyCJWASTIUXJQLGA-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1OC2=CC=CC(=C2)C)(O)O

Computed by PubChem (NCBI)