CAS 156642-03-4 appears in our catalog under these names: 4'–Methoxybiphenyl–4–ylboronic acid, (4-(4-Methoxyphenyl)phenyl)boronic acid, 95-<97%, (4-(4-Methoxyphenyl)phenyl)boronic acid, ≥97-<99%, (4'-Methoxy-[1,1'-biphenyl]-4-yl)boronic acid, 95%, (4'-Methoxy-[1,1'-biphenyl]-4-yl)boronic acid, 98%. Offered by: GLPBio, Hoffman Fine Chemicals, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 50g, 100g, 200g, 300g.
[4-(4-methoxyphenyl)phenyl]boronic acid (CAS 156642-03-4) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: [4-(4-methoxyphenyl)phenyl]boronic acid. InChIKey: VIHQQLWZRRVBNE-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | [4-(4-methoxyphenyl)phenyl]boronic acid |
| InChIKey | VIHQQLWZRRVBNE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)