Products 2121511-97-3
CAS 2121511-97-3 appears in our catalog under these names: 2-Methoxy-4-biphenylboronic acid, 95%, (2-Methoxy-[1,1'-biphenyl]-4-yl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
(3-methoxy-4-phenylphenyl)boronic acid (CAS 2121511-97-3) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: (3-methoxy-4-phenylphenyl)boronic acid. InChIKey: QPEBGCLQPCQHHI-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | (3-methoxy-4-phenylphenyl)boronic acid |
| InChIKey | QPEBGCLQPCQHHI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Methoxy-4-biphenylboronic acid, (2-Methoxy-[1,1'-biphenyl]-4-yl)boronic acid, (3-methoxy-4-phenylphenyl)boronic acid, {2-methoxy-[1,1'-biphenyl]-4-yl}boronic acid, Boronic acid, B-(2-methoxy[1,1'-biphenyl]-4-yl)-, (3-methoxy-4-phenyl-phenyl)boronic acid, (2-Methoxy[1,1'-biphenyl]-4-yl)boronic acid, Boronic acid, B-(2-methoxy[1,1?-biphenyl]-4-yl)-, Boronic acid, B-(2-methoxy[1,1a(2)-biphenyl]-4-yl)-, Boronic acid, B-(2-methoxy[1,1 inverted exclamation marka-biphenyl]-4-yl)-