CAS 1221823-69-3 appears in our catalog under these names: 4-Hydroxy(phenyl)methylphenylboronic acid, 95%, 4-Hydroxy(phenyl)methylphenylboronic acid, 95%, 95%, (4-(Hydroxy(phenyl)methyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
[4-[hydroxy(phenyl)methyl]phenyl]boronic acid (CAS 1221823-69-3) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: [4-[hydroxy(phenyl)methyl]phenyl]boronic acid. InChIKey: KZDVEVNHPYZAEI-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | [4-[hydroxy(phenyl)methyl]phenyl]boronic acid |
| InChIKey | KZDVEVNHPYZAEI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C2=CC=CC=C2)O)(O)O |
Computed by PubChem (NCBI)