Products 146631-00-7
CAS 146631-00-7 appears in our catalog under these names: 4-Benzyloxyphenylboronic acid/ 95+%, 4–(Benzyloxy)phenylboronic acid (contains varying amounts of Anhydride), 4-Benzyloxyphenylboronic Acid (contains varying amounts of Anhydride), (4-(Benzyloxy)phenyl)boronic acid, 98%, 98%, 4-Benzyloxyphenylboronic acid, 99.90%. Offered by: Chemat, GLPBio, TCI, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 100g, 10g, 25g, 50g, 500g, 25 g.
(4-phenylmethoxyphenyl)boronic acid (CAS 146631-00-7) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: (4-phenylmethoxyphenyl)boronic acid. InChIKey: DMJHEIDWSIAXCS-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl)boronic acid |
| InChIKey | DMJHEIDWSIAXCS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Benzyloxy-phenylboronic acid, 4-Benzyloxyphenylboronic acid, 4-Benzyloxybenzeneboronic Acid, (4-(Benzyloxy)phenyl)boronic acid, 4-(Benzyloxy)phenylboronic acid, [4-(benzyloxy)phenyl]boronic acid, (4-phenylmethoxyphenyl)boronic Acid, (4-benzyloxyphenyl)boronic acid, Boronic acid, [4-(phenylmethoxy)phenyl]-, 4-benzyloxy benzene boronic acid