CAS 2305931-63-7 appears in our catalog under these names: (2-Methyl-6-(trifluoromethyl)phenyl)boronic acid, (2-Methyl-6-(trifluoromethyl)phenyl)boronic acid, 98+%, 98+%, (2-Methyl-6-(trifluoromethyl)phenyl)boronic acid, 98+%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,025g, 1g, 100mg, 250mg.
[2-methyl-6-(trifluoromethyl)phenyl]boronic acid (CAS 2305931-63-7) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [2-methyl-6-(trifluoromethyl)phenyl]boronic acid. InChIKey: GWUVIOMQOXAQQH-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [2-methyl-6-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GWUVIOMQOXAQQH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)