CAS 2135600-85-8 is the registry number for [2-(1,1-difluoroethyl)-4-fluoro-phenyl]boronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
[2-(1,1-difluoroethyl)-4-fluorophenyl]boronic acid (CAS 2135600-85-8) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [2-(1,1-difluoroethyl)-4-fluorophenyl]boronic acid. InChIKey: MHSXLEBGAGNZAH-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [2-(1,1-difluoroethyl)-4-fluorophenyl]boronic acid |
| InChIKey | MHSXLEBGAGNZAH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)C(C)(F)F)(O)O |
Computed by PubChem (NCBI)