Products 947533-96-2
CAS 947533-96-2 appears in our catalog under these names: 2-Methyl-5-(trifluoromethyl)phenylboronic acid, 96%, 96%, 2-Methyl-5-(trifluoromethyl)phenyl boronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
[2-methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 947533-96-2) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [2-methyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: WFARXIDYQNIXLI-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [2-methyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WFARXIDYQNIXLI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)