CAS 1620056-82-7 is the registry number for (3-(2,2,2-Trifluoroethyl)phenyl)boronic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[3-(2,2,2-trifluoroethyl)phenyl]boronic acid (CAS 1620056-82-7) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [3-(2,2,2-trifluoroethyl)phenyl]boronic acid. InChIKey: FAPWKTBQRHIKJJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [3-(2,2,2-trifluoroethyl)phenyl]boronic acid |
| InChIKey | FAPWKTBQRHIKJJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC(F)(F)F)(O)O |
Computed by PubChem (NCBI)