cas: 4230-21-1 — see every product listed under this CAS number, including other names
(2-Phenoxyethyl)hydrazine hydrochloride, 97% (CAS 4230-21-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A464302-10g |
| cas | 4230-21-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13526.17 Pln | |
| AmBeed | 5g | 9717.82 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-phenoxyethylamino)azanium chloride (CAS 4230-21-1) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: (2-phenoxyethylamino)azanium chloride. InChIKey: KDJBRRKMKRWPBZ-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | (2-phenoxyethylamino)azanium chloride |
| InChIKey | KDJBRRKMKRWPBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCN[NH3+].[Cl-] |
Computed by PubChem (NCBI)