CAS 1914157-93-9 appears in our catalog under these names: (S)-1-(2-Methoxypyridin-4-yl)ethanamine hydrochloride, 95%, (S)–1–(2–Methoxypyridin–4–yl)ethanamine hydrochloride, (S)-1-(2-Methoxypyridin-4-yl)ethanamine hydrochloride 96%, (S)-1-(2-Methoxypyridin-4-yl)ethanamine hydrochloride, 96%, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S)-1-(2-methoxy-4-pyridinyl)ethanamine;hydrochloride (CAS 1914157-93-9) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: (1S)-1-(2-methoxy-4-pyridinyl)ethanamine;hydrochloride. InChIKey: QQVOVRIZVVJBJS-RGMNGODLSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | (1S)-1-(2-methoxy-4-pyridinyl)ethanamine;hydrochloride |
| InChIKey | QQVOVRIZVVJBJS-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=NC=C1)OC)N.Cl |
Computed by PubChem (NCBI)