Products 1803581-17-0

CAS 1803581-17-0 is the registry number for 5-Methyl-3-(pyrrolidin-2-yl)-1,2-oxazole hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

5-methyl-3-pyrrolidin-2-yl-1,2-oxazole;hydrochloride (CAS 1803581-17-0) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: 5-methyl-3-pyrrolidin-2-yl-1,2-oxazole;hydrochloride. InChIKey: LOPSWGJOXXDQSO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O
Molecular weight188.65 g/mol
IUPAC name5-methyl-3-pyrrolidin-2-yl-1,2-oxazole;hydrochloride
InChIKeyLOPSWGJOXXDQSO-UHFFFAOYSA-N
SMILESCC1=CC(=NO1)C2CCCN2.Cl

Computed by PubChem (NCBI)