CAS 1173081-96-3 appears in our catalog under these names: 3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride, 3-(Aminomethyl)-4,6-dimethyl-1h-pyridin-2-one hydrochloride, 95%, 3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride 95%, 3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride, 97%, 97%, 3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one hydrochloride, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,25g, 2,5g, 25g, 5g, 1g, 100g, 250mg, 10g.
3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride (CAS 1173081-96-3) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride. InChIKey: ZMDPNGUJHPRAMG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridin-2-one;hydrochloride |
| InChIKey | ZMDPNGUJHPRAMG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)C.Cl |
Computed by PubChem (NCBI)