CAS 4230-21-1 appears in our catalog under these names: 1-(2-phenoxyethyl)hydrazine, 1-(2-Phenoxyethyl)hydrazine hydrochloride, 95%, (2-Phenoxyethyl)hydrazine hydrochloride, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 10g, 5g, 1g, 250mg.
(2-phenoxyethylamino)azanium chloride (CAS 4230-21-1) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: (2-phenoxyethylamino)azanium chloride. InChIKey: KDJBRRKMKRWPBZ-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | (2-phenoxyethylamino)azanium chloride |
| InChIKey | KDJBRRKMKRWPBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCN[NH3+].[Cl-] |
Computed by PubChem (NCBI)