Products 1624262-52-7

CAS 1624262-52-7 is the registry number for 2-(5-Methoxypyridin-2-yl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-(5-methoxy-2-pyridinyl)ethanamine;hydrochloride (CAS 1624262-52-7) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: 2-(5-methoxy-2-pyridinyl)ethanamine;hydrochloride. InChIKey: RAIMXAUYCGGOAX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O
Molecular weight188.65 g/mol
IUPAC name2-(5-methoxy-2-pyridinyl)ethanamine;hydrochloride
InChIKeyRAIMXAUYCGGOAX-UHFFFAOYSA-N
SMILESCOC1=CN=C(C=C1)CCN.Cl

Computed by PubChem (NCBI)