cas: 76387-70-7 — see every product listed under this CAS number, including other names
(2R)-3-amino-2-(tert-butoxycarbonylamino)propanoic acid, 97% (CAS 76387-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146YW-100mg |
| cas | 76387-70-7 |
| size | 100mg |
| availability | 157.9g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 50g | 438.80 Pln | |
| Chemat | 100g | 813.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 76387-70-7) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)