CAS 73259-81-1 appears in our catalog under these names: Boc–Dap–OH, Boc-L-Dap-OH, N-alpha-Boc-L-2,3-diaminopropionic acid, (S)-3-Amino-2-(tert-butoxycarbonylamino)propionic Acid, >95.0%(HPLC)(T), Boc-Dap-OH 97%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 25g, 5g, 100g, 1g, 50g, 500g, 250g.
(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 73259-81-1) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)