CAS 76387-70-7 appears in our catalog under these names: Boc–D–Dap–OH, Boc-D-Dap-OH, N(alpha)-Boc-D-2,3-diaminopropionic acid, 97% , Boc-D-Dap-OH 97%, (2R)-3-amino-2-(tert-butoxycarbonylamino)propanoic acid, 97%, 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 50g, 1g, 250mg, 1000g.
(2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 76387-70-7) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2R)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)