cas: 489446-77-7 — see every product listed under this CAS number, including other names
(2R,4S)-4-AMINO-1-CBZ-PYRROLIDINE-2-CARBOXYLIC ACID METHYL ESTER-HCl, 95%, 95% (CAS 489446-77-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DECB-1g |
| cas | 489446-77-7 |
| size | 1g |
| availability | 22g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1350.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 489446-77-7) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: VLLRSJJKBDFSMT-ZVWHLABXSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | VLLRSJJKBDFSMT-ZVWHLABXSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)