CAS 201014-19-9 appears in our catalog under these names: H-D-Lys(2-cl-z)-oh, 95%, (R)-2-Amino-6-((((2-chlorobenzyl)oxy)carbonyl)amino)hexanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
(2R)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid (CAS 201014-19-9) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: (2R)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid. InChIKey: YCQVFPIEKSYHFI-GFCCVEGCSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | (2R)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid |
| InChIKey | YCQVFPIEKSYHFI-GFCCVEGCSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)NCCCC[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)