Products 1217455-34-9

CAS 1217455-34-9 is the registry number for 1-Benzyl 2-methyl (R)-piperazine-1,2-dicarboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-O-benzyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride (CAS 1217455-34-9) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride. InChIKey: QRUPZPVVRPOJKT-UTONKHPSSA-N.

Identity
Molecular formulaC14H19ClN2O4
Molecular weight314.76 g/mol
IUPAC name1-O-benzyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride
InChIKeyQRUPZPVVRPOJKT-UTONKHPSSA-N
SMILESCOC(=O)[C@H]1CNCCN1C(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)