Products 1436504-98-1
CAS 1436504-98-1 is the registry number for Ethyl 6-(((tert-butoxycarbonyl)amino)methyl)-3-chloropicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-chloro-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carboxylate (CAS 1436504-98-1) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: ethyl 3-chloro-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carboxylate. InChIKey: GGCOCQFUAVKWIA-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | ethyl 3-chloro-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carboxylate |
| InChIKey | GGCOCQFUAVKWIA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)CNC(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)