CAS 489446-77-7 appears in our catalog under these names: (2R,4S)-4-Amino-1-cbz-pyrrolidine-2-carboxylic acid methyl ester hydrochloride, 95%, (2R,4S)-1-Benzyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, 95%, (2R,4S)–1–Benzyl 2–methyl 4–aminopyrrolidine–1,2–dicarboxylate hydrochloride, (2R,4S)-4-AMINO-1-CBZ-PYRROLIDINE-2-CARBOXYLIC ACID METHYL ESTER-HCl, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg.
1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 489446-77-7) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: VLLRSJJKBDFSMT-ZVWHLABXSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | VLLRSJJKBDFSMT-ZVWHLABXSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)