CAS 409325-33-3 appears in our catalog under these names: (2S,4R)-4-Amino-1-cbz-pyrrolidine-2-carboxylic acid methyl ester hydrochloride, 95%, Cbz-4-NH2-Pro-OMe HCl 95%, (2S,4R)-4-Amino-1-cbz-pyrrolidine-2-carboxylic acid methyl ester-hcl, 95%, 95%, Methyl (2S,4R)-4-amino-1-Cbz-pyrrolidine-2-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g, 25mg.
1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 409325-33-3) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: VLLRSJJKBDFSMT-LYCTWNKOSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | VLLRSJJKBDFSMT-LYCTWNKOSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)