cas: 2155902-41-1 — see every product listed under this CAS number, including other names
(2S)-2-[4-(Boc-amino)-2-oxo-1-pyrrolidinyl]propanoic Acid, ≥97%, ≥97% (CAS 2155902-41-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12TJTQ-1g |
| cas | 2155902-41-1 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3851.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidin-1-yl]propanoic acid (CAS 2155902-41-1) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: (2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidin-1-yl]propanoic acid. InChIKey: CYTYYYDNPYXXOF-JAMMHHFISA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidin-1-yl]propanoic acid |
| InChIKey | CYTYYYDNPYXXOF-JAMMHHFISA-N |
| SMILES | C[C@@H](C(=O)O)N1CC(CC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)