CAS 1105663-94-2 appears in our catalog under these names: 1-tert-Butyl 3-ethyl 3-carbamoylazetidine-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-ethyl 3-carbamoylazetidine-1,3-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
1-O-tert-butyl 3-O-ethyl 3-carbamoylazetidine-1,3-dicarboxylate (CAS 1105663-94-2) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-carbamoylazetidine-1,3-dicarboxylate. InChIKey: TYHWSMCZSPERFP-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-carbamoylazetidine-1,3-dicarboxylate |
| InChIKey | TYHWSMCZSPERFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)C(=O)N |
Computed by PubChem (NCBI)