CAS 82611-51-6 appears in our catalog under these names: (R)-2-(3-(tert-Butoxycarbonylamino)-2-oxopiperidin-1-yl)acetic acid, 95%, (R)-2-(3-(tert-Butoxycarbonylamino)-2-oxopiperidin-1-yl)acetic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg, 1g.
2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-1-yl]acetic acid (CAS 82611-51-6) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: 2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-1-yl]acetic acid. InChIKey: GLPLDJICXMMSBB-MRVPVSSYSA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-1-yl]acetic acid |
| InChIKey | GLPLDJICXMMSBB-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(C1=O)CC(=O)O |
Computed by PubChem (NCBI)