CAS 939997-63-4 appears in our catalog under these names: 4-Acetyl-piperazine-1,2-dicarboxylic acid 1-tert-butyl ester, 96%, 4-Acetyl-1-(tert-butoxycarbonyl)piperazine-2-carboxylic acid 95%, 4-Acetyl-piperazine-1,2-dicarboxylic acid 1-tert-butyl ester, 99%, 99%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 939997-63-4) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: 4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: PRRWYZYTMLYQMT-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | PRRWYZYTMLYQMT-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(C(C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)