CAS 330970-70-2 appears in our catalog under these names: (S)-2-((S)-2-(Allyloxycarbonylamino)-3-methylbutanamido)propanoic acid, 95%, N-Alloc-L-valyl-L-alanine, ((Allyloxy)carbonyl)–L–valyl–L–alanine, Alloc-Val-Ala-OH 95%, N-Alloc-L-valyl-L-alanine, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g, 100g, 500 mg.
(2S)-2-[[(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]propanoic acid (CAS 330970-70-2) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: (2S)-2-[[(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]propanoic acid. InChIKey: LOIWGNGKOQWZSA-IUCAKERBSA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2S)-2-[[(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]propanoic acid |
| InChIKey | LOIWGNGKOQWZSA-IUCAKERBSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)OCC=C |
Computed by PubChem (NCBI)