CAS 741267-75-4 is the registry number for Nirmatrelvir Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoic acid (CAS 741267-75-4) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoic acid. InChIKey: RWCCIYJJIFJDQO-YUMQZZPRSA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoic acid |
| InChIKey | RWCCIYJJIFJDQO-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)O |
Computed by PubChem (NCBI)