cas: 5505-63-5 — see every product listed under this CAS number, including other names
(2S,3R,4S,5R)-2-Amino-3,4,5,6-tetrahydroxyhexanal hydrochloride, 95% (CAS 5505-63-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093487-250MG |
| cas | 5505-63-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 669.57 Pln | |
| Fluorochem | 100g | 2372.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 5505-63-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: CBOJBBMQJBVCMW-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | CBOJBBMQJBVCMW-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)N)O)O)O)O.Cl |
Computed by PubChem (NCBI)