cas: 5505-63-5 — see every product listed under this CAS number, including other names
D-Mannosamine (hydrochloride), 98.0% (CAS 5505-63-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 500 mg, 50 g, 100 g, 25 g, 1 g, 10 g, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W021425-5 g |
| cas | 5505-63-5 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1271.71 Pln | |
| MedChemExpress | 500 mg | 361.49 Pln | |
| MedChemExpress | 50 g | 3955.94 Pln | |
| MedChemExpress | 100 g | 4917.25 Pln | |
| MedChemExpress | 25 g | 3068.94 Pln | |
| MedChemExpress | 1 g | 505.45 Pln | |
| MedChemExpress | 10 g | 2089.06 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.0% |
(2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 5505-63-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: CBOJBBMQJBVCMW-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | CBOJBBMQJBVCMW-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)N)O)O)O)O.Cl |
Computed by PubChem (NCBI)