cas: 5505-63-5 — see every product listed under this CAS number, including other names
D-Mannosamine hydrochloride, 98.00% (CAS 5505-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10mg, 1g, 500mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM17640C-100mg |
| cas | 5505-63-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 254.27 Pln | |
| Chemat | 10mg | 129.43 Pln | |
| Chemat | 1g | 674.59 Pln | |
| Chemat | 500mg | 464.40 Pln | |
| Chemat | 5g | 1932.32 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 5505-63-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: CBOJBBMQJBVCMW-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | CBOJBBMQJBVCMW-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)N)O)O)O)O.Cl |
Computed by PubChem (NCBI)