cas: 5505-63-5 — see every product listed under this CAS number, including other names
D-Mannosamine Hydrochloride, >95.0%(HPLC) (CAS 5505-63-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3237-1G |
| cas | 5505-63-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 354.37 Pln | |
| TCI | 5g | 1180.47 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC) |
(2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 5505-63-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: CBOJBBMQJBVCMW-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | CBOJBBMQJBVCMW-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)N)O)O)O)O.Cl |
Computed by PubChem (NCBI)