cas: 929558-08-7 — see every product listed under this CAS number, including other names
(2S,3S)-2,3-Dihydroxybutane-1,4-diyl dibenzoate, 95%, 95% (CAS 929558-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117JY8-100mg |
| cas | 929558-08-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(2S,3S)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate (CAS 929558-08-7) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: [(2S,3S)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate. InChIKey: DJOUKNAKSJTIKP-HOTGVXAUSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(2S,3S)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate |
| InChIKey | DJOUKNAKSJTIKP-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]([C@H](COC(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)