CAS 4136-22-5 appears in our catalog under these names: (-)-Dibenzyl d-tartrate, 98%, (–)–DIBENZYL D–TARTRATE, (-)-DIBENZYL D-TARTRATE, >=98.0% HPLC&, (2S,3S)-Dibenzyl 2,3-Dihydroxysuccinate, 97%, 97%, (2S,3S)-Dibenzyl 2,3-dihydroxysuccinate, 95%. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
Dibenzyl (2S,3S)-2,3-dihydroxybutanedioate (CAS 4136-22-5) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: dibenzyl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: LCKIPSGLXMCAOF-HOTGVXAUSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | dibenzyl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | LCKIPSGLXMCAOF-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H]([C@@H](C(=O)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)