CAS 176590-77-5 is the registry number for (2R,3R)-2,3-Dihydroxybutane-1,4-diyl dibenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[(2R,3R)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate (CAS 176590-77-5) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: [(2R,3R)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate. InChIKey: DJOUKNAKSJTIKP-HZPDHXFCSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(2R,3R)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate |
| InChIKey | DJOUKNAKSJTIKP-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@H]([C@@H](COC(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)