CAS 7674-99-9 is the registry number for Diethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Diethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate (CAS 7674-99-9) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: diethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate. InChIKey: CFKGXXNWAGBBFU-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | diethyl 2,6-dimethylfuro[2,3-f][1]benzofuran-3,7-dicarboxylate |
| InChIKey | CFKGXXNWAGBBFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC2=CC3=C(C=C21)OC(=C3C(=O)OCC)C)C |
Computed by PubChem (NCBI)