CAS 929558-08-7 appears in our catalog under these names: (2S,3S)-2,3-Dihydroxybutane-1,4-diyl dibenzoate, 97%, (2S,3S)-2,3-Dihydroxybutane-1,4-diyl dibenzoate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
[(2S,3S)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate (CAS 929558-08-7) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: [(2S,3S)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate. InChIKey: DJOUKNAKSJTIKP-HOTGVXAUSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(2S,3S)-4-benzoyloxy-2,3-dihydroxybutyl] benzoate |
| InChIKey | DJOUKNAKSJTIKP-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]([C@H](COC(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)