CAS 622-00-4 appears in our catalog under these names: L-Tartaric acid dibenzyl ester, 95%, Dibenzyl L-Tartrate, 96%, Dibenzyl L–Tartrate, Dibenzyl L-Tartrate, >97.0%(GC), Dibenzyl L-Tartrate, 96%, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 250g, 5g, 100g, 1g, 100mg, 250mg, 10g.
Dibenzyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 622-00-4) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: dibenzyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: LCKIPSGLXMCAOF-HZPDHXFCSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | dibenzyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | LCKIPSGLXMCAOF-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H]([C@H](C(=O)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)