cas: 4136-22-5 — see every product listed under this CAS number, including other names
(2S,3S)-Dibenzyl 2,3-Dihydroxysuccinate, 97%, 97% (CAS 4136-22-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXSO-250mg |
| cas | 4136-22-5 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 25g | 1422.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dibenzyl (2S,3S)-2,3-dihydroxybutanedioate (CAS 4136-22-5) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: dibenzyl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: LCKIPSGLXMCAOF-HOTGVXAUSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | dibenzyl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | LCKIPSGLXMCAOF-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H]([C@@H](C(=O)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)