(2S,3S)-Diisopropyl 2,3-dihydroxysuccinate, 98%
cas: 62961-64-2 — see every product listed under this CAS number, including other names
(2S,3S)-Diisopropyl 2,3-dihydroxysuccinate, 98% (CAS 62961-64-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114BBI-5g |
| cas | 62961-64-2 |
| size | 5g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 50g | 141.20 Pln | |
| Chemat | 100g | 213.20 Pln | |
| Chemat | 250g | 424.40 Pln | |
| Chemat | 500g | 820.80 Pln | |
| Chemat | 1kg | 1422.80 Pln | |
| BLDpharm | 10g | 142.20 Pln | |
| BLDpharm | 25g | 203.29 Pln | |
| BLDpharm | 100g | 369.89 Pln | |
| BLDpharm | 500g | 1119.63 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate (CAS 62961-64-2) is a chemical compound with the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. IUPAC name: dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: XEBCWEDRGPSHQH-YUMQZZPRSA-N.
| Molecular formula | C10H18O6 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | XEBCWEDRGPSHQH-YUMQZZPRSA-N |
| SMILES | CC(C)OC(=O)[C@H]([C@@H](C(=O)OC(C)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Butanedioic acid, 2,3-dihydroxy-, bis(1-methylethyl) ester, (2S,3S)-, Diisopropyl (S-(R*,R*))-tartrate, Diisopropyl [S-(R*,R*)]-tartrate, Diisopropyl (-)-tartrate, Diisopropyl d-tartrate, (2S,3S)-Diisopropyl 2,3-dihydroxysuccinate, (-)-Diisopropyl D-tartrate, D-(-)-Tartaric acid diisopropyl ester, Diisopropyl D-(-)-Tartrate, dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate
