cas: 189215-90-5 — see every product listed under this CAS number, including other names
(2S,4R)-1-BENZYL 2-METHYL 4-(TERT-BUTOXYCARBONYLAMINO)PYRROLIDINE-1,2-DICARBOXYLATE, 98%, 98% (CAS 189215-90-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113I41-100mg |
| cas | 189215-90-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 2075.60 Pln | |
| Chemat | 10g | 3285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate (CAS 189215-90-5) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate. InChIKey: UVWVPIDBHIWJLK-CABCVRRESA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate |
| InChIKey | UVWVPIDBHIWJLK-CABCVRRESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)