CAS 489446-67-5 is the registry number for 1-Benzyl 2-methyl (2R,4S)-4-((tert-butoxycarbonyl)amino)pyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-benzyl 2-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate (CAS 489446-67-5) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate. InChIKey: UVWVPIDBHIWJLK-LSDHHAIUSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate |
| InChIKey | UVWVPIDBHIWJLK-LSDHHAIUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)